C11H13NO — CID 90845496
1-(3-amino-2,3-dihydro-1H-inden-5-yl)ethanone (PubChem CID 90845496) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-(3-amino-2,3-dihydro-1H-inden-5-yl)ethanone.
| Compound Name | 1-(3-amino-2,3-dihydro-1H-inden-5-yl)ethanone |
|---|---|
| PubChem CID | 90845496 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 1-(3-amino-2,3-dihydro-1H-inden-5-yl)ethanone |
| SMILES | CC(=O)c1ccc2c(c1)C(N)CC2 |
| InChI | InChI=1S/C11H13NO/c1-7(13)9-3-2-8-4-5-11(12)10(8)6-9/h2-3,6,11H,4-5,12H2,1H3 |
| InChIKey | VXQURTZQAQADKR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |