C13H19N3 — CID 21338580
N'-(3-amino-2,3-dihydro-1H-inden-5-yl)-N,N-dimethylethanimidamide (PubChem CID 21338580) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is N'-(3-amino-2,3-dihydro-1H-inden-5-yl)-N,N-dimethylethanimidamide.
| Compound Name | N'-(3-amino-2,3-dihydro-1H-inden-5-yl)-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 21338580 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N'-(3-amino-2,3-dihydro-1H-inden-5-yl)-N,N-dimethylethanimidamide |
| SMILES | C/C(=N\c1ccc2c(c1)C(N)CC2)N(C)C |
| InChI | InChI=1S/C13H19N3/c1-9(16(2)3)15-11-6-4-10-5-7-13(14)12(10)8-11/h4,6,8,13H,5,7,14H2,1-3H3/b15-9+ |
| InChIKey | UFOKDFXPTQHWTQ-OQLLNIDSSA-N |
| XLogP | 2.24 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|