C12H16N2OS — CID 11242761
O-[(1-amino-2,3-dihydro-1H-inden-5-yl)] N,N-dimethylcarbamothioate (PubChem CID 11242761) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is O-[(1-amino-2,3-dihydro-1H-inden-5-yl)] N,N-dimethylcarbamothioate.
| Compound Name | O-[(1-amino-2,3-dihydro-1H-inden-5-yl)] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 11242761 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | O-[(1-amino-2,3-dihydro-1H-inden-5-yl)] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=S)Oc1ccc2c(c1)CCC2N |
| InChI | InChI=1S/C12H16N2OS/c1-14(2)12(16)15-9-4-5-10-8(7-9)3-6-11(10)13/h4-5,7,11H,3,6,13H2,1-2H3 |
| InChIKey | DXXYEWHRSVUCIR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|