C19H40N4O9S2 — CID 88537868
2-[4-(2-hydroxyethyl)-3-[3-hydroxy-3-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethylsulfonyloxy]propyl]piperazin-1-yl]ethanesulfonic acid (PubChem CID 88537868) has the molecular formula C19H40N4O9S2 and a molecular weight of 532.68 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)-3-[3-hydroxy-3-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethylsulfonyloxy]propyl]piperazin-1-yl]ethanesulfonic acid.
| Compound Name | 2-[4-(2-hydroxyethyl)-3-[3-hydroxy-3-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethylsulfonyloxy]propyl]piperazin-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 88537868 |
| Molecular Formula | C19H40N4O9S2 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)-3-[3-hydroxy-3-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethylsulfonyloxy]propyl]piperazin-1-yl]ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCN1CCN(CCO)C(CCC(O)OS(=O)(=O)CCN2CCN(CCO)CC2)C1 |
| InChI | InChI=1S/C19H40N4O9S2/c24-13-9-20-3-5-21(6-4-20)12-16-34(30,31)32-19(26)2-1-18-17-22(11-15-33(27,28)29)7-8-23(18)10-14-25/h18-19,24-26H,1-17H2,(H,27,28,29) |
| InChIKey | WKWMPKJOFNMUAN-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 171.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|