C10H22N2O5S — CID 141252993
2-[2-(1-hydroxyethyl)-4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid (PubChem CID 141252993) has the molecular formula C10H22N2O5S and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-[2-(1-hydroxyethyl)-4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid.
| Compound Name | 2-[2-(1-hydroxyethyl)-4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 141252993 |
| Molecular Formula | C10H22N2O5S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-[2-(1-hydroxyethyl)-4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid |
| SMILES | CC(O)C1CN(CCO)CCN1CCS(=O)(=O)O |
| InChI | InChI=1S/C10H22N2O5S/c1-9(14)10-8-11(4-6-13)2-3-12(10)5-7-18(15,16)17/h9-10,13-14H,2-8H2,1H3,(H,15,16,17) |
| InChIKey | JLRZVJNQOJAAHW-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|