C12H27N3O12S3 — CID 89332996
2-[4,7-bis(2-sulfooxyethyl)-1,4,7-triazonan-1-yl]ethyl hydrogen sulfate (PubChem CID 89332996) has the molecular formula C12H27N3O12S3 and a molecular weight of 501.56 g/mol. Its IUPAC name is 2-[4,7-bis(2-sulfooxyethyl)-1,4,7-triazonan-1-yl]ethyl hydrogen sulfate.
| Compound Name | 2-[4,7-bis(2-sulfooxyethyl)-1,4,7-triazonan-1-yl]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 89332996 |
| Molecular Formula | C12H27N3O12S3 |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | 2-[4,7-bis(2-sulfooxyethyl)-1,4,7-triazonan-1-yl]ethyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OCCN1CCN(CCOS(=O)(=O)O)CCN(CCOS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C12H27N3O12S3/c16-28(17,18)25-10-7-13-1-2-14(8-11-26-29(19,20)21)5-6-15(4-3-13)9-12-27-30(22,23)24/h1-12H2,(H,16,17,18)(H,19,20,21)(H,22,23,24) |
| InChIKey | XCUJLGUSKSLPHJ-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 200.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|