About 1-butylpiperidine;propyl hydrogen sulfate
1-butylpiperidine;propyl hydrogen sulfate (PubChem CID 173126609) has the molecular formula C12H27NO4S
and a molecular weight of 281.42 g/mol. Its IUPAC name is 1-butylpiperidine;propyl hydrogen sulfate.
Molecular Properties
| Compound Name | 1-butylpiperidine;propyl hydrogen sulfate |
| PubChem CID | 173126609 |
| Molecular Formula | C12H27NO4S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-butylpiperidine;propyl hydrogen sulfate |
| SMILES | CCCCN1CCCCC1.CCCOS(=O)(=O)O |
| InChI | InChI=1S/C9H19N.C3H8O4S/c1-2-3-7-10-8-5-4-6-9-10;1-2-3-7-8(4,5)6/h2-9H2,1H3;2-3H2,1H3,(H,4,5,6) |
| InChIKey | JZMFDQZGCPSIHR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butylpiperidine;propyl hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylpiperidine;propyl hydrogen sulfate?
The IUPAC name of 1-butylpiperidine;propyl hydrogen sulfate (CID 173126609) is 1-butylpiperidine;propyl hydrogen sulfate.
What is the SMILES notation for 1-butylpiperidine;propyl hydrogen sulfate?
The canonical SMILES for 1-butylpiperidine;propyl hydrogen sulfate is CCCCN1CCCCC1.CCCOS(=O)(=O)O.
What is the InChIKey of 1-butylpiperidine;propyl hydrogen sulfate?
The InChIKey is JZMFDQZGCPSIHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C3H8O4S/c1-2-3-7-10-8-5-4-6-9-10;1-2-3-7-8(4,5)6/h2-9H2,1H3;2-3H2,1H3,(H,4,5,6).
What are the key properties of 1-butylpiperidine;propyl hydrogen sulfate?
1-butylpiperidine;propyl hydrogen sulfate has a molecular weight of 281.42 g/mol, XLogP of 2.49, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylpiperidine;propyl hydrogen sulfate is sourced from PubChem (CID 173126609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).