C32H34N4O4 — CID 56607209
N-[1-[3-(4-benzhydrylpiperazin-1-yl)propyl]-2,3-dioxoindol-5-yl]-2-oxobutanamide (PubChem CID 56607209) has the molecular formula C32H34N4O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is N-[1-[3-(4-benzhydrylpiperazin-1-yl)propyl]-2,3-dioxoindol-5-yl]-2-oxobutanamide.
| Compound Name | N-[1-[3-(4-benzhydrylpiperazin-1-yl)propyl]-2,3-dioxoindol-5-yl]-2-oxobutanamide |
|---|---|
| PubChem CID | 56607209 |
| Molecular Formula | C32H34N4O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | N-[1-[3-(4-benzhydrylpiperazin-1-yl)propyl]-2,3-dioxoindol-5-yl]-2-oxobutanamide |
| SMILES | CCC(=O)C(=O)Nc1ccc2c(c1)C(=O)C(=O)N2CCCN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C32H34N4O4/c1-2-28(37)31(39)33-25-14-15-27-26(22-25)30(38)32(40)36(27)17-9-16-34-18-20-35(21-19-34)29(23-10-5-3-6-11-23)24-12-7-4-8-13-24/h3-8,10-15,22,29H,2,9,16-21H2,1H3,(H,33,39) |
| InChIKey | MLDJHSMWNWZIMI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|