C29H33Cl2N3O2 — CID 20502539
1-[3-(4-benzhydrylpiperazin-1-yl)propyl]-5-methylindole-2,3-dione;dihydrochloride (PubChem CID 20502539) has the molecular formula C29H33Cl2N3O2 and a molecular weight of 526.51 g/mol. Its IUPAC name is 1-[3-(4-benzhydrylpiperazin-1-yl)propyl]-5-methylindole-2,3-dione;dihydrochloride.
| Compound Name | 1-[3-(4-benzhydrylpiperazin-1-yl)propyl]-5-methylindole-2,3-dione;dihydrochloride |
|---|---|
| PubChem CID | 20502539 |
| Molecular Formula | C29H33Cl2N3O2 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 1-[3-(4-benzhydrylpiperazin-1-yl)propyl]-5-methylindole-2,3-dione;dihydrochloride |
| SMILES | Cc1ccc2c(c1)C(=O)C(=O)N2CCCN1CCN(C(c2ccccc2)c2ccccc2)CC1.Cl.Cl |
| InChI | InChI=1S/C29H31N3O2.2ClH/c1-22-13-14-26-25(21-22)28(33)29(34)32(26)16-8-15-30-17-19-31(20-18-30)27(23-9-4-2-5-10-23)24-11-6-3-7-12-24;;/h2-7,9-14,21,27H,8,15-20H2,1H3;2*1H |
| InChIKey | FEWVGVMJAANHQK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|