C31H32N2O6 — CID 174332261
1-[2-(1-benzylpiperidin-4-yl)ethyl]indole-2,3-dione;5-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174332261) has the molecular formula C31H32N2O6 and a molecular weight of 528.61 g/mol. Its IUPAC name is 1-[2-(1-benzylpiperidin-4-yl)ethyl]indole-2,3-dione;5-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | 1-[2-(1-benzylpiperidin-4-yl)ethyl]indole-2,3-dione;5-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174332261 |
| Molecular Formula | C31H32N2O6 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 1-[2-(1-benzylpiperidin-4-yl)ethyl]indole-2,3-dione;5-methylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1cc(C(=O)O)cc(C(=O)O)c1.O=C1C(=O)N(CCC2CCN(Cc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C22H24N2O2.C9H8O4/c25-21-19-8-4-5-9-20(19)24(22(21)26)15-12-17-10-13-23(14-11-17)16-18-6-2-1-3-7-18;1-5-2-6(8(10)11)4-7(3-5)9(12)13/h1-9,17H,10-16H2;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | XTHHBRHARVCSPJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|