C17H25NO2 — CID 62216017
3-[1-[(3,5-dimethylphenyl)methyl]piperidin-4-yl]propanoic acid (PubChem CID 62216017) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 3-[1-[(3,5-dimethylphenyl)methyl]piperidin-4-yl]propanoic acid.
| Compound Name | 3-[1-[(3,5-dimethylphenyl)methyl]piperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 62216017 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-[1-[(3,5-dimethylphenyl)methyl]piperidin-4-yl]propanoic acid |
| SMILES | Cc1cc(C)cc(CN2CCC(CCC(=O)O)CC2)c1 |
| InChI | InChI=1S/C17H25NO2/c1-13-9-14(2)11-16(10-13)12-18-7-5-15(6-8-18)3-4-17(19)20/h9-11,15H,3-8,12H2,1-2H3,(H,19,20) |
| InChIKey | HTQIMISBUUAKHH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |