C16H23ClN2O2 — CID 68846400
2-[1-[(3-chloro-5-methylphenyl)methyl]piperidin-4-yl]ethylcarbamic acid (PubChem CID 68846400) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 2-[1-[(3-chloro-5-methylphenyl)methyl]piperidin-4-yl]ethylcarbamic acid.
| Compound Name | 2-[1-[(3-chloro-5-methylphenyl)methyl]piperidin-4-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 68846400 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[1-[(3-chloro-5-methylphenyl)methyl]piperidin-4-yl]ethylcarbamic acid |
| SMILES | Cc1cc(Cl)cc(CN2CCC(CCNC(=O)O)CC2)c1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-12-8-14(10-15(17)9-12)11-19-6-3-13(4-7-19)2-5-18-16(20)21/h8-10,13,18H,2-7,11H2,1H3,(H,20,21) |
| InChIKey | GENICHYRAFCVHD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |