C22H26N2O2 — CID 22068236
2-[2-(1-benzylpiperidin-4-yl)ethyl]-6-methyl-1,2-benzoxazol-3-one (PubChem CID 22068236) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 2-[2-(1-benzylpiperidin-4-yl)ethyl]-6-methyl-1,2-benzoxazol-3-one.
| Compound Name | 2-[2-(1-benzylpiperidin-4-yl)ethyl]-6-methyl-1,2-benzoxazol-3-one |
|---|---|
| PubChem CID | 22068236 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-[2-(1-benzylpiperidin-4-yl)ethyl]-6-methyl-1,2-benzoxazol-3-one |
| SMILES | Cc1ccc2c(=O)n(CCC3CCN(Cc4ccccc4)CC3)oc2c1 |
| InChI | InChI=1S/C22H26N2O2/c1-17-7-8-20-21(15-17)26-24(22(20)25)14-11-18-9-12-23(13-10-18)16-19-5-3-2-4-6-19/h2-8,15,18H,9-14,16H2,1H3 |
| InChIKey | RVASAQJVOILJSF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |