C23H26N2O4 — CID 22068175
benzyl 4-[3-(3-oxo-1,2-benzoxazol-2-yl)propyl]piperidine-1-carboxylate (PubChem CID 22068175) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is benzyl 4-[3-(3-oxo-1,2-benzoxazol-2-yl)propyl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[3-(3-oxo-1,2-benzoxazol-2-yl)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 22068175 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | benzyl 4-[3-(3-oxo-1,2-benzoxazol-2-yl)propyl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(CCCn2oc3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C23H26N2O4/c26-22-20-10-4-5-11-21(20)29-25(22)14-6-9-18-12-15-24(16-13-18)23(27)28-17-19-7-2-1-3-8-19/h1-5,7-8,10-11,18H,6,9,12-17H2 |
| InChIKey | LDPUREGAGJOCNR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |