C20H25N — CID 130137270
1-benzyl-4-(2,5-dimethylphenyl)piperidine (PubChem CID 130137270) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is 1-benzyl-4-(2,5-dimethylphenyl)piperidine.
| Compound Name | 1-benzyl-4-(2,5-dimethylphenyl)piperidine |
|---|---|
| PubChem CID | 130137270 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 1-benzyl-4-(2,5-dimethylphenyl)piperidine |
| SMILES | Cc1ccc(C)c(C2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H25N/c1-16-8-9-17(2)20(14-16)19-10-12-21(13-11-19)15-18-6-4-3-5-7-18/h3-9,14,19H,10-13,15H2,1-2H3 |
| InChIKey | HMKABBRLGBJPQO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |