C22H30N2 — CID 122176958
1-benzyl-N-[1-(2,5-dimethylphenyl)ethyl]piperidin-4-amine (PubChem CID 122176958) has the molecular formula C22H30N2 and a molecular weight of 322.50 g/mol. Its IUPAC name is 1-benzyl-N-[1-(2,5-dimethylphenyl)ethyl]piperidin-4-amine.
| Compound Name | 1-benzyl-N-[1-(2,5-dimethylphenyl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 122176958 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 1-benzyl-N-[1-(2,5-dimethylphenyl)ethyl]piperidin-4-amine |
| SMILES | Cc1ccc(C)c(C(C)NC2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H30N2/c1-17-9-10-18(2)22(15-17)19(3)23-21-11-13-24(14-12-21)16-20-7-5-4-6-8-20/h4-10,15,19,21,23H,11-14,16H2,1-3H3 |
| InChIKey | DCVRUDMOESYUPJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |