C21H27N — CID 143140323
1-benzyl-4-(2-propylphenyl)piperidine (PubChem CID 143140323) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-benzyl-4-(2-propylphenyl)piperidine.
| Compound Name | 1-benzyl-4-(2-propylphenyl)piperidine |
|---|---|
| PubChem CID | 143140323 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-benzyl-4-(2-propylphenyl)piperidine |
| SMILES | CCCc1ccccc1C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H27N/c1-2-8-19-11-6-7-12-21(19)20-13-15-22(16-14-20)17-18-9-4-3-5-10-18/h3-7,9-12,20H,2,8,13-17H2,1H3 |
| InChIKey | BVRLPKJNWKGPFO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |