2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid

C10H5BrFNO4 — CID 61355936

IUPAC2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid
SMILESO=C(O)CN1C(=O)C(=O)c2cc(F)cc(Br)c21
InChIInChI=1S/C10H5BrFNO4/c11-6-2-4(12)1-5-8(6)13(3-7(14)15)10(17)9(5)16/h1-2H,3H2,(H,14,15)
InChIKeyJFTNVRAKYWXZQJ-UHFFFAOYSA-N
MW302.06 g/mol
LogP1.20
Rot. Bonds2

About 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid

2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid (PubChem CID 61355936) has the molecular formula C10H5BrFNO4 and a molecular weight of 302.06 g/mol. Its IUPAC name is 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid.

Molecular Properties

Compound Name2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid
PubChem CID61355936
Molecular FormulaC10H5BrFNO4
Molecular Weight302.06 g/mol
Exact Mass300.94
IUPAC Name2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid
SMILESO=C(O)CN1C(=O)C(=O)c2cc(F)cc(Br)c21
InChIInChI=1S/C10H5BrFNO4/c11-6-2-4(12)1-5-8(6)13(3-7(14)15)10(17)9(5)16/h1-2H,3H2,(H,14,15)
InChIKeyJFTNVRAKYWXZQJ-UHFFFAOYSA-N
XLogP1.20
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.06
LogP ≤ 51.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid?
The IUPAC name of 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid (CID 61355936) is 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid.
What is the SMILES notation for 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid?
The canonical SMILES for 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid is O=C(O)CN1C(=O)C(=O)c2cc(F)cc(Br)c21.
What is the InChIKey of 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid?
The InChIKey is JFTNVRAKYWXZQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrFNO4/c11-6-2-4(12)1-5-8(6)13(3-7(14)15)10(17)9(5)16/h1-2H,3H2,(H,14,15).
What are the key properties of 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid?
2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid has a molecular weight of 302.06 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid is sourced from PubChem (CID 61355936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).