C10H5BrFNO4 — CID 61355936
2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid (PubChem CID 61355936) has the molecular formula C10H5BrFNO4 and a molecular weight of 302.06 g/mol. Its IUPAC name is 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid.
| Compound Name | 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid |
|---|---|
| PubChem CID | 61355936 |
| Molecular Formula | C10H5BrFNO4 |
| Molecular Weight | 302.06 g/mol |
| Exact Mass | 300.94 |
| IUPAC Name | 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)acetic acid |
| SMILES | O=C(O)CN1C(=O)C(=O)c2cc(F)cc(Br)c21 |
| InChI | InChI=1S/C10H5BrFNO4/c11-6-2-4(12)1-5-8(6)13(3-7(14)15)10(17)9(5)16/h1-2H,3H2,(H,14,15) |
| InChIKey | JFTNVRAKYWXZQJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.06 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|