About 7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione
7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione (PubChem CID 61356769) has the molecular formula C15H8Br2FNO2
and a molecular weight of 413.04 g/mol. Its IUPAC name is 7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione.
Molecular Properties
| Compound Name | 7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione |
| PubChem CID | 61356769 |
| Molecular Formula | C15H8Br2FNO2 |
| Molecular Weight | 413.04 g/mol |
| Exact Mass | 410.89 |
| IUPAC Name | 7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2ccccc2Br)c2c(Br)cc(F)cc21 |
| InChI | InChI=1S/C15H8Br2FNO2/c16-11-4-2-1-3-8(11)7-19-13-10(14(20)15(19)21)5-9(18)6-12(13)17/h1-6H,7H2 |
| InChIKey | LSMMQRSDYVNJCS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.04 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione?
The IUPAC name of 7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione (CID 61356769) is 7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione.
What is the SMILES notation for 7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione?
The canonical SMILES for 7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione is O=C1C(=O)N(Cc2ccccc2Br)c2c(Br)cc(F)cc21.
What is the InChIKey of 7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione?
The InChIKey is LSMMQRSDYVNJCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8Br2FNO2/c16-11-4-2-1-3-8(11)7-19-13-10(14(20)15(19)21)5-9(18)6-12(13)17/h1-6H,7H2.
What are the key properties of 7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione?
7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione has a molecular weight of 413.04 g/mol, XLogP of 4.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-[(2-bromophenyl)methyl]-5-fluoroindole-2,3-dione is sourced from PubChem (CID 61356769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).