C10H6Br2FNO2 — CID 61356601
7-bromo-1-(2-bromoethyl)-5-fluoroindole-2,3-dione (PubChem CID 61356601) has the molecular formula C10H6Br2FNO2 and a molecular weight of 350.97 g/mol. Its IUPAC name is 7-bromo-1-(2-bromoethyl)-5-fluoroindole-2,3-dione.
| Compound Name | 7-bromo-1-(2-bromoethyl)-5-fluoroindole-2,3-dione |
|---|---|
| PubChem CID | 61356601 |
| Molecular Formula | C10H6Br2FNO2 |
| Molecular Weight | 350.97 g/mol |
| Exact Mass | 348.87 |
| IUPAC Name | 7-bromo-1-(2-bromoethyl)-5-fluoroindole-2,3-dione |
| SMILES | O=C1C(=O)N(CCBr)c2c(Br)cc(F)cc21 |
| InChI | InChI=1S/C10H6Br2FNO2/c11-1-2-14-8-6(9(15)10(14)16)3-5(13)4-7(8)12/h3-4H,1-2H2 |
| InChIKey | PLXJOZTXLIGJJM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.97 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|