C11H9BrFNO2 — CID 106893506
1-(2-bromoethyl)-5-fluoro-7-methylindole-2,3-dione (PubChem CID 106893506) has the molecular formula C11H9BrFNO2 and a molecular weight of 286.10 g/mol. Its IUPAC name is 1-(2-bromoethyl)-5-fluoro-7-methylindole-2,3-dione.
| Compound Name | 1-(2-bromoethyl)-5-fluoro-7-methylindole-2,3-dione |
|---|---|
| PubChem CID | 106893506 |
| Molecular Formula | C11H9BrFNO2 |
| Molecular Weight | 286.10 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 1-(2-bromoethyl)-5-fluoro-7-methylindole-2,3-dione |
| SMILES | Cc1cc(F)cc2c1N(CCBr)C(=O)C2=O |
| InChI | InChI=1S/C11H9BrFNO2/c1-6-4-7(13)5-8-9(6)14(3-2-12)11(16)10(8)15/h4-5H,2-3H2,1H3 |
| InChIKey | UDAMYUGVYCAXFT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.10 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|