C13H12FNO2 — CID 106893650
1-[(E)-but-2-enyl]-5-fluoro-7-methylindole-2,3-dione (PubChem CID 106893650) has the molecular formula C13H12FNO2 and a molecular weight of 233.24 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-5-fluoro-7-methylindole-2,3-dione.
| Compound Name | 1-[(E)-but-2-enyl]-5-fluoro-7-methylindole-2,3-dione |
|---|---|
| PubChem CID | 106893650 |
| Molecular Formula | C13H12FNO2 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 1-[(E)-but-2-enyl]-5-fluoro-7-methylindole-2,3-dione |
| SMILES | C/C=C/CN1C(=O)C(=O)c2cc(F)cc(C)c21 |
| InChI | InChI=1S/C13H12FNO2/c1-3-4-5-15-11-8(2)6-9(14)7-10(11)12(16)13(15)17/h3-4,6-7H,5H2,1-2H3/b4-3+ |
| InChIKey | SKGYHPAFWFWPRA-ONEGZZNKSA-N |
| XLogP | 2.24 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|