C15H18FNO3 — CID 106893795
5-fluoro-1-(3-methoxy-3-methylbutyl)-7-methylindole-2,3-dione (PubChem CID 106893795) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is 5-fluoro-1-(3-methoxy-3-methylbutyl)-7-methylindole-2,3-dione.
| Compound Name | 5-fluoro-1-(3-methoxy-3-methylbutyl)-7-methylindole-2,3-dione |
|---|---|
| PubChem CID | 106893795 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 5-fluoro-1-(3-methoxy-3-methylbutyl)-7-methylindole-2,3-dione |
| SMILES | COC(C)(C)CCN1C(=O)C(=O)c2cc(F)cc(C)c21 |
| InChI | InChI=1S/C15H18FNO3/c1-9-7-10(16)8-11-12(9)17(14(19)13(11)18)6-5-15(2,3)20-4/h7-8H,5-6H2,1-4H3 |
| InChIKey | OILXXQJIUVZBIS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|