C13H12BrFN2O3 — CID 61355939
2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-N-ethyl-N-methylacetamide (PubChem CID 61355939) has the molecular formula C13H12BrFN2O3 and a molecular weight of 343.15 g/mol. Its IUPAC name is 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-N-ethyl-N-methylacetamide.
| Compound Name | 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-N-ethyl-N-methylacetamide |
|---|---|
| PubChem CID | 61355939 |
| Molecular Formula | C13H12BrFN2O3 |
| Molecular Weight | 343.15 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 2-(7-bromo-5-fluoro-2,3-dioxoindol-1-yl)-N-ethyl-N-methylacetamide |
| SMILES | CCN(C)C(=O)CN1C(=O)C(=O)c2cc(F)cc(Br)c21 |
| InChI | InChI=1S/C13H12BrFN2O3/c1-3-16(2)10(18)6-17-11-8(12(19)13(17)20)4-7(15)5-9(11)14/h4-5H,3,6H2,1-2H3 |
| InChIKey | SRYBBOWMQFUUBB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.15 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|