C19H17Br2NO3 — CID 18802657
7-bromo-1-[4-(4-bromophenoxy)butyl]-5-methylindole-2,3-dione (PubChem CID 18802657) has the molecular formula C19H17Br2NO3 and a molecular weight of 467.16 g/mol. Its IUPAC name is 7-bromo-1-[4-(4-bromophenoxy)butyl]-5-methylindole-2,3-dione.
| Compound Name | 7-bromo-1-[4-(4-bromophenoxy)butyl]-5-methylindole-2,3-dione |
|---|---|
| PubChem CID | 18802657 |
| Molecular Formula | C19H17Br2NO3 |
| Molecular Weight | 467.16 g/mol |
| Exact Mass | 464.96 |
| IUPAC Name | 7-bromo-1-[4-(4-bromophenoxy)butyl]-5-methylindole-2,3-dione |
| SMILES | Cc1cc(Br)c2c(c1)C(=O)C(=O)N2CCCCOc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H17Br2NO3/c1-12-10-15-17(16(21)11-12)22(19(24)18(15)23)8-2-3-9-25-14-6-4-13(20)5-7-14/h4-7,10-11H,2-3,8-9H2,1H3 |
| InChIKey | PMDQANMIBPMXSZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.16 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|