C18H16BrNO3 — CID 18802621
7-bromo-5-methyl-1-(3-phenoxypropyl)indole-2,3-dione (PubChem CID 18802621) has the molecular formula C18H16BrNO3 and a molecular weight of 374.23 g/mol. Its IUPAC name is 7-bromo-5-methyl-1-(3-phenoxypropyl)indole-2,3-dione.
| Compound Name | 7-bromo-5-methyl-1-(3-phenoxypropyl)indole-2,3-dione |
|---|---|
| PubChem CID | 18802621 |
| Molecular Formula | C18H16BrNO3 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 7-bromo-5-methyl-1-(3-phenoxypropyl)indole-2,3-dione |
| SMILES | Cc1cc(Br)c2c(c1)C(=O)C(=O)N2CCCOc1ccccc1 |
| InChI | InChI=1S/C18H16BrNO3/c1-12-10-14-16(15(19)11-12)20(18(22)17(14)21)8-5-9-23-13-6-3-2-4-7-13/h2-4,6-7,10-11H,5,8-9H2,1H3 |
| InChIKey | RHIBPKYALGAIGN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|