C19H16BrCl2NO3 — CID 18802654
7-bromo-1-[4-(2,3-dichlorophenoxy)butyl]-5-methylindole-2,3-dione (PubChem CID 18802654) has the molecular formula C19H16BrCl2NO3 and a molecular weight of 457.15 g/mol. Its IUPAC name is 7-bromo-1-[4-(2,3-dichlorophenoxy)butyl]-5-methylindole-2,3-dione.
| Compound Name | 7-bromo-1-[4-(2,3-dichlorophenoxy)butyl]-5-methylindole-2,3-dione |
|---|---|
| PubChem CID | 18802654 |
| Molecular Formula | C19H16BrCl2NO3 |
| Molecular Weight | 457.15 g/mol |
| Exact Mass | 454.97 |
| IUPAC Name | 7-bromo-1-[4-(2,3-dichlorophenoxy)butyl]-5-methylindole-2,3-dione |
| SMILES | Cc1cc(Br)c2c(c1)C(=O)C(=O)N2CCCCOc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H16BrCl2NO3/c1-11-9-12-17(13(20)10-11)23(19(25)18(12)24)7-2-3-8-26-15-6-4-5-14(21)16(15)22/h4-6,9-10H,2-3,7-8H2,1H3 |
| InChIKey | MIOQVMAWVDUMSA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.15 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|