C19H16BrCl2NO4 — CID 18802724
8-bromo-1-[4-(2,3-dichlorophenoxy)butyl]-6-methyl-3,1-benzoxazine-2,4-dione (PubChem CID 18802724) has the molecular formula C19H16BrCl2NO4 and a molecular weight of 473.15 g/mol. Its IUPAC name is 8-bromo-1-[4-(2,3-dichlorophenoxy)butyl]-6-methyl-3,1-benzoxazine-2,4-dione.
| Compound Name | 8-bromo-1-[4-(2,3-dichlorophenoxy)butyl]-6-methyl-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 18802724 |
| Molecular Formula | C19H16BrCl2NO4 |
| Molecular Weight | 473.15 g/mol |
| Exact Mass | 470.96 |
| IUPAC Name | 8-bromo-1-[4-(2,3-dichlorophenoxy)butyl]-6-methyl-3,1-benzoxazine-2,4-dione |
| SMILES | Cc1cc(Br)c2c(c1)c(=O)oc(=O)n2CCCCOc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H16BrCl2NO4/c1-11-9-12-17(13(20)10-11)23(19(25)27-18(12)24)7-2-3-8-26-15-6-4-5-14(21)16(15)22/h4-6,9-10H,2-3,7-8H2,1H3 |
| InChIKey | LMGZEAJVWZRGLJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.15 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|