C17H14ClNO4 — CID 18803591
8-chloro-1-[2-(3-methylphenoxy)ethyl]-3,1-benzoxazine-2,4-dione (PubChem CID 18803591) has the molecular formula C17H14ClNO4 and a molecular weight of 331.76 g/mol. Its IUPAC name is 8-chloro-1-[2-(3-methylphenoxy)ethyl]-3,1-benzoxazine-2,4-dione.
| Compound Name | 8-chloro-1-[2-(3-methylphenoxy)ethyl]-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 18803591 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 8-chloro-1-[2-(3-methylphenoxy)ethyl]-3,1-benzoxazine-2,4-dione |
| SMILES | Cc1cccc(OCCn2c(=O)oc(=O)c3cccc(Cl)c32)c1 |
| InChI | InChI=1S/C17H14ClNO4/c1-11-4-2-5-12(10-11)22-9-8-19-15-13(6-3-7-14(15)18)16(20)23-17(19)21/h2-7,10H,8-9H2,1H3 |
| InChIKey | FGEXYEQPCPXKOT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |