C17H14ClNO5 — CID 18803593
8-chloro-1-[2-(4-methoxyphenoxy)ethyl]-3,1-benzoxazine-2,4-dione (PubChem CID 18803593) has the molecular formula C17H14ClNO5 and a molecular weight of 347.75 g/mol. Its IUPAC name is 8-chloro-1-[2-(4-methoxyphenoxy)ethyl]-3,1-benzoxazine-2,4-dione.
| Compound Name | 8-chloro-1-[2-(4-methoxyphenoxy)ethyl]-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 18803593 |
| Molecular Formula | C17H14ClNO5 |
| Molecular Weight | 347.75 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 8-chloro-1-[2-(4-methoxyphenoxy)ethyl]-3,1-benzoxazine-2,4-dione |
| SMILES | COc1ccc(OCCn2c(=O)oc(=O)c3cccc(Cl)c32)cc1 |
| InChI | InChI=1S/C17H14ClNO5/c1-22-11-5-7-12(8-6-11)23-10-9-19-15-13(3-2-4-14(15)18)16(20)24-17(19)21/h2-8H,9-10H2,1H3 |
| InChIKey | SAUAPIMFXYHYSV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 70.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |