C13H14ClNO3 — CID 18803585
8-chloro-1-(3-methylbutyl)-3,1-benzoxazine-2,4-dione (PubChem CID 18803585) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is 8-chloro-1-(3-methylbutyl)-3,1-benzoxazine-2,4-dione.
| Compound Name | 8-chloro-1-(3-methylbutyl)-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 18803585 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 8-chloro-1-(3-methylbutyl)-3,1-benzoxazine-2,4-dione |
| SMILES | CC(C)CCn1c(=O)oc(=O)c2cccc(Cl)c21 |
| InChI | InChI=1S/C13H14ClNO3/c1-8(2)6-7-15-11-9(4-3-5-10(11)14)12(16)18-13(15)17/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | HXNWAVZWENMVTQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |