C9H6ClNO3 — CID 26724
6-chloro-1-methyl-3,1-benzoxazine-2,4-dione (PubChem CID 26724) has the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. Its IUPAC name is 6-chloro-1-methyl-3,1-benzoxazine-2,4-dione.
| Compound Name | 6-chloro-1-methyl-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 26724 |
| Molecular Formula | C9H6ClNO3 |
| Molecular Weight | 211.60 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 6-chloro-1-methyl-3,1-benzoxazine-2,4-dione |
| SMILES | Cn1c(=O)oc(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C9H6ClNO3/c1-11-7-3-2-5(10)4-6(7)8(12)14-9(11)13/h2-4H,1H3 |
| InChIKey | FKTQNWWDMJDNHA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.60 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |