C11H9NO3 — CID 735787
1-prop-2-enyl-3,1-benzoxazine-2,4-dione (PubChem CID 735787) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 1-prop-2-enyl-3,1-benzoxazine-2,4-dione.
| Compound Name | 1-prop-2-enyl-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 735787 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 1-prop-2-enyl-3,1-benzoxazine-2,4-dione |
| SMILES | C=CCn1c(=O)oc(=O)c2ccccc21 |
| InChI | InChI=1S/C11H9NO3/c1-2-7-12-9-6-4-3-5-8(9)10(13)15-11(12)14/h2-6H,1,7H2 |
| InChIKey | LPYKDXKUIKQFQI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|