C22H18ClNO4 — CID 18803635
8-chloro-1-(4-naphthalen-2-yloxybutyl)-3,1-benzoxazine-2,4-dione (PubChem CID 18803635) has the molecular formula C22H18ClNO4 and a molecular weight of 395.84 g/mol. Its IUPAC name is 8-chloro-1-(4-naphthalen-2-yloxybutyl)-3,1-benzoxazine-2,4-dione.
| Compound Name | 8-chloro-1-(4-naphthalen-2-yloxybutyl)-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 18803635 |
| Molecular Formula | C22H18ClNO4 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 8-chloro-1-(4-naphthalen-2-yloxybutyl)-3,1-benzoxazine-2,4-dione |
| SMILES | O=c1oc(=O)n(CCCCOc2ccc3ccccc3c2)c2c(Cl)cccc12 |
| InChI | InChI=1S/C22H18ClNO4/c23-19-9-5-8-18-20(19)24(22(26)28-21(18)25)12-3-4-13-27-17-11-10-15-6-1-2-7-16(15)14-17/h1-2,5-11,14H,3-4,12-13H2 |
| InChIKey | ZVDBSLBANHDKKN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|