C19H17Cl2NO4 — CID 18803165
6-chloro-1-[4-(4-chloro-3-methylphenoxy)butyl]-3,1-benzoxazine-2,4-dione (PubChem CID 18803165) has the molecular formula C19H17Cl2NO4 and a molecular weight of 394.25 g/mol. Its IUPAC name is 6-chloro-1-[4-(4-chloro-3-methylphenoxy)butyl]-3,1-benzoxazine-2,4-dione.
| Compound Name | 6-chloro-1-[4-(4-chloro-3-methylphenoxy)butyl]-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 18803165 |
| Molecular Formula | C19H17Cl2NO4 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 6-chloro-1-[4-(4-chloro-3-methylphenoxy)butyl]-3,1-benzoxazine-2,4-dione |
| SMILES | Cc1cc(OCCCCn2c(=O)oc(=O)c3cc(Cl)ccc32)ccc1Cl |
| InChI | InChI=1S/C19H17Cl2NO4/c1-12-10-14(5-6-16(12)21)25-9-3-2-8-22-17-7-4-13(20)11-15(17)18(23)26-19(22)24/h4-7,10-11H,2-3,8-9H2,1H3 |
| InChIKey | HTORVONSHKJPQM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|