C21H22BrNO3 — CID 18802651
7-bromo-1-[4-(2,3-dimethylphenoxy)butyl]-5-methylindole-2,3-dione (PubChem CID 18802651) has the molecular formula C21H22BrNO3 and a molecular weight of 416.32 g/mol. Its IUPAC name is 7-bromo-1-[4-(2,3-dimethylphenoxy)butyl]-5-methylindole-2,3-dione.
| Compound Name | 7-bromo-1-[4-(2,3-dimethylphenoxy)butyl]-5-methylindole-2,3-dione |
|---|---|
| PubChem CID | 18802651 |
| Molecular Formula | C21H22BrNO3 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 7-bromo-1-[4-(2,3-dimethylphenoxy)butyl]-5-methylindole-2,3-dione |
| SMILES | Cc1cc(Br)c2c(c1)C(=O)C(=O)N2CCCCOc1cccc(C)c1C |
| InChI | InChI=1S/C21H22BrNO3/c1-13-11-16-19(17(22)12-13)23(21(25)20(16)24)9-4-5-10-26-18-8-6-7-14(2)15(18)3/h6-8,11-12H,4-5,9-10H2,1-3H3 |
| InChIKey | UGWIYMNRFDLDQO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|