C18H17NO3 — CID 18802236
1-[2-(2,3-dimethylphenoxy)ethyl]indole-2,3-dione (PubChem CID 18802236) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-[2-(2,3-dimethylphenoxy)ethyl]indole-2,3-dione.
| Compound Name | 1-[2-(2,3-dimethylphenoxy)ethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 18802236 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-[2-(2,3-dimethylphenoxy)ethyl]indole-2,3-dione |
| SMILES | Cc1cccc(OCCN2C(=O)C(=O)c3ccccc32)c1C |
| InChI | InChI=1S/C18H17NO3/c1-12-6-5-9-16(13(12)2)22-11-10-19-15-8-4-3-7-14(15)17(20)18(19)21/h3-9H,10-11H2,1-2H3 |
| InChIKey | ZOKKEOPDTFNSAV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|