C20H21NO3 — CID 3157902
1-[2-(4-tert-butylphenoxy)ethyl]indole-2,3-dione (PubChem CID 3157902) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenoxy)ethyl]indole-2,3-dione.
| Compound Name | 1-[2-(4-tert-butylphenoxy)ethyl]indole-2,3-dione |
|---|---|
| PubChem CID | 3157902 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-[2-(4-tert-butylphenoxy)ethyl]indole-2,3-dione |
| SMILES | CC(C)(C)c1ccc(OCCN2C(=O)C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H21NO3/c1-20(2,3)14-8-10-15(11-9-14)24-13-12-21-17-7-5-4-6-16(17)18(22)19(21)23/h4-11H,12-13H2,1-3H3 |
| InChIKey | LXKCZZYVXCGCRP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|