C17H13Cl2NO3 — CID 18803273
1-[2-(2,5-dichlorophenoxy)ethyl]-7-methylindole-2,3-dione (PubChem CID 18803273) has the molecular formula C17H13Cl2NO3 and a molecular weight of 350.20 g/mol. Its IUPAC name is 1-[2-(2,5-dichlorophenoxy)ethyl]-7-methylindole-2,3-dione.
| Compound Name | 1-[2-(2,5-dichlorophenoxy)ethyl]-7-methylindole-2,3-dione |
|---|---|
| PubChem CID | 18803273 |
| Molecular Formula | C17H13Cl2NO3 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 1-[2-(2,5-dichlorophenoxy)ethyl]-7-methylindole-2,3-dione |
| SMILES | Cc1cccc2c1N(CCOc1cc(Cl)ccc1Cl)C(=O)C2=O |
| InChI | InChI=1S/C17H13Cl2NO3/c1-10-3-2-4-12-15(10)20(17(22)16(12)21)7-8-23-14-9-11(18)5-6-13(14)19/h2-6,9H,7-8H2,1H3 |
| InChIKey | YGBPQHRVCXLALP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|