C19H17BrClNO3 — CID 18802639
7-bromo-1-[3-(4-chloro-3-methylphenoxy)propyl]-5-methylindole-2,3-dione (PubChem CID 18802639) has the molecular formula C19H17BrClNO3 and a molecular weight of 422.71 g/mol. Its IUPAC name is 7-bromo-1-[3-(4-chloro-3-methylphenoxy)propyl]-5-methylindole-2,3-dione.
| Compound Name | 7-bromo-1-[3-(4-chloro-3-methylphenoxy)propyl]-5-methylindole-2,3-dione |
|---|---|
| PubChem CID | 18802639 |
| Molecular Formula | C19H17BrClNO3 |
| Molecular Weight | 422.71 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 7-bromo-1-[3-(4-chloro-3-methylphenoxy)propyl]-5-methylindole-2,3-dione |
| SMILES | Cc1cc(Br)c2c(c1)C(=O)C(=O)N2CCCOc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C19H17BrClNO3/c1-11-8-14-17(15(20)9-11)22(19(24)18(14)23)6-3-7-25-13-4-5-16(21)12(2)10-13/h4-5,8-10H,3,6-7H2,1-2H3 |
| InChIKey | JSYDFGSQZJLXBV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.71 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|