C12H11BrFNO2S — CID 113473738
5-bromo-6-fluoro-1-(3-methylsulfanylpropyl)indole-2,3-dione (PubChem CID 113473738) has the molecular formula C12H11BrFNO2S and a molecular weight of 332.19 g/mol. Its IUPAC name is 5-bromo-6-fluoro-1-(3-methylsulfanylpropyl)indole-2,3-dione.
| Compound Name | 5-bromo-6-fluoro-1-(3-methylsulfanylpropyl)indole-2,3-dione |
|---|---|
| PubChem CID | 113473738 |
| Molecular Formula | C12H11BrFNO2S |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | 5-bromo-6-fluoro-1-(3-methylsulfanylpropyl)indole-2,3-dione |
| SMILES | CSCCCN1C(=O)C(=O)c2cc(Br)c(F)cc21 |
| InChI | InChI=1S/C12H11BrFNO2S/c1-18-4-2-3-15-10-6-9(14)8(13)5-7(10)11(16)12(15)17/h5-6H,2-4H2,1H3 |
| InChIKey | QXHVAHLKWRGFOH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|