About 3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide
3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide (PubChem CID 61360079) has the molecular formula C13H12BrFN2O3
and a molecular weight of 343.15 g/mol. Its IUPAC name is 3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide |
| PubChem CID | 61360079 |
| Molecular Formula | C13H12BrFN2O3 |
| Molecular Weight | 343.15 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCN1C(=O)C(=O)c2cc(Br)c(F)cc21 |
| InChI | InChI=1S/C13H12BrFN2O3/c1-16(2)11(18)3-4-17-10-6-9(15)8(14)5-7(10)12(19)13(17)20/h5-6H,3-4H2,1-2H3 |
| InChIKey | MWERFVVRMCIVRY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.15 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide?
The IUPAC name of 3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide (CID 61360079) is 3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide.
What is the SMILES notation for 3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide?
The canonical SMILES for 3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide is CN(C)C(=O)CCN1C(=O)C(=O)c2cc(Br)c(F)cc21.
What is the InChIKey of 3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide?
The InChIKey is MWERFVVRMCIVRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrFN2O3/c1-16(2)11(18)3-4-17-10-6-9(15)8(14)5-7(10)12(19)13(17)20/h5-6H,3-4H2,1-2H3.
What are the key properties of 3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide?
3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide has a molecular weight of 343.15 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-bromo-6-fluoro-2,3-dioxoindol-1-yl)-N,N-dimethylpropanamide is sourced from PubChem (CID 61360079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).