C18H20FN3O3 — CID 157289548
4-[7-fluoro-2-methyl-4-oxo-5-(propan-2-ylamino)quinazolin-3-yl]cyclohexane-1,3-dione (PubChem CID 157289548) has the molecular formula C18H20FN3O3 and a molecular weight of 345.37 g/mol. Its IUPAC name is 4-[7-fluoro-2-methyl-4-oxo-5-(propan-2-ylamino)quinazolin-3-yl]cyclohexane-1,3-dione.
| Compound Name | 4-[7-fluoro-2-methyl-4-oxo-5-(propan-2-ylamino)quinazolin-3-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 157289548 |
| Molecular Formula | C18H20FN3O3 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 4-[7-fluoro-2-methyl-4-oxo-5-(propan-2-ylamino)quinazolin-3-yl]cyclohexane-1,3-dione |
| SMILES | Cc1nc2cc(F)cc(NC(C)C)c2c(=O)n1C1CCC(=O)CC1=O |
| InChI | InChI=1S/C18H20FN3O3/c1-9(2)20-13-6-11(19)7-14-17(13)18(25)22(10(3)21-14)15-5-4-12(23)8-16(15)24/h6-7,9,15,20H,4-5,8H2,1-3H3 |
| InChIKey | BAQHPMASPWHDCK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|