C15H14N2O4 — CID 147199581
4-(6-hydroxy-2-methyl-4-oxoquinazolin-3-yl)cyclohexane-1,3-dione (PubChem CID 147199581) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 4-(6-hydroxy-2-methyl-4-oxoquinazolin-3-yl)cyclohexane-1,3-dione.
| Compound Name | 4-(6-hydroxy-2-methyl-4-oxoquinazolin-3-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 147199581 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-(6-hydroxy-2-methyl-4-oxoquinazolin-3-yl)cyclohexane-1,3-dione |
| SMILES | Cc1nc2ccc(O)cc2c(=O)n1C1CCC(=O)CC1=O |
| InChI | InChI=1S/C15H14N2O4/c1-8-16-12-4-2-9(18)6-11(12)15(21)17(8)13-5-3-10(19)7-14(13)20/h2,4,6,13,18H,3,5,7H2,1H3 |
| InChIKey | CDAYGWVOMTZDDK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|