C14H14FN3O4 — CID 156578298
7-fluoro-5-hydroxy-3-(2-hydroxy-6-oxopiperidin-3-yl)-2-methylquinazolin-4-one (PubChem CID 156578298) has the molecular formula C14H14FN3O4 and a molecular weight of 307.28 g/mol. Its IUPAC name is 7-fluoro-5-hydroxy-3-(2-hydroxy-6-oxopiperidin-3-yl)-2-methylquinazolin-4-one.
| Compound Name | 7-fluoro-5-hydroxy-3-(2-hydroxy-6-oxopiperidin-3-yl)-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 156578298 |
| Molecular Formula | C14H14FN3O4 |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 7-fluoro-5-hydroxy-3-(2-hydroxy-6-oxopiperidin-3-yl)-2-methylquinazolin-4-one |
| SMILES | Cc1nc2cc(F)cc(O)c2c(=O)n1C1CCC(=O)NC1O |
| InChI | InChI=1S/C14H14FN3O4/c1-6-16-8-4-7(15)5-10(19)12(8)14(22)18(6)9-2-3-11(20)17-13(9)21/h4-5,9,13,19,21H,2-3H2,1H3,(H,17,20) |
| InChIKey | NBRKIGMOFMCHPT-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |