C15H14F3N3O3 — CID 130358797
3-(2-hydroxy-6-oxopiperidin-3-yl)-2-methyl-5-(trifluoromethyl)quinazolin-4-one (PubChem CID 130358797) has the molecular formula C15H14F3N3O3 and a molecular weight of 341.29 g/mol. Its IUPAC name is 3-(2-hydroxy-6-oxopiperidin-3-yl)-2-methyl-5-(trifluoromethyl)quinazolin-4-one.
| Compound Name | 3-(2-hydroxy-6-oxopiperidin-3-yl)-2-methyl-5-(trifluoromethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 130358797 |
| Molecular Formula | C15H14F3N3O3 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 3-(2-hydroxy-6-oxopiperidin-3-yl)-2-methyl-5-(trifluoromethyl)quinazolin-4-one |
| SMILES | Cc1nc2cccc(C(F)(F)F)c2c(=O)n1C1CCC(=O)NC1O |
| InChI | InChI=1S/C15H14F3N3O3/c1-7-19-9-4-2-3-8(15(16,17)18)12(9)14(24)21(7)10-5-6-11(22)20-13(10)23/h2-4,10,13,23H,5-6H2,1H3,(H,20,22) |
| InChIKey | GBNYWNYBGRBLJA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |