C25H35N5O7S — CID 170639059
4-amino-N-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]ethoxy]ethyl]piperidine-1-sulfinamide (PubChem CID 170639059) has the molecular formula C25H35N5O7S and a molecular weight of 549.65 g/mol. Its IUPAC name is 4-amino-N-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]ethoxy]ethyl]piperidine-1-sulfinamide.
| Compound Name | 4-amino-N-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]ethoxy]ethyl]piperidine-1-sulfinamide |
|---|---|
| PubChem CID | 170639059 |
| Molecular Formula | C25H35N5O7S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | 4-amino-N-[2-[2-[3-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]propoxy]ethoxy]ethyl]piperidine-1-sulfinamide |
| SMILES | NC1CCN(S(=O)NCCOCCOCCCc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C25H35N5O7S/c26-18-8-11-29(12-9-18)38(35)27-10-14-37-16-15-36-13-2-4-17-3-1-5-19-22(17)25(34)30(24(19)33)20-6-7-21(31)28-23(20)32/h1,3,5,18,20,27H,2,4,6-16,26H2,(H,28,31,32) |
| InChIKey | MGLKDHHFIBIIIO-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 160.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|