C16H26N4O3 — CID 56827108
tert-butyl N-methyl-N-[2-(1-pyridin-3-ylethylcarbamoylamino)ethyl]carbamate (PubChem CID 56827108) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-(1-pyridin-3-ylethylcarbamoylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-(1-pyridin-3-ylethylcarbamoylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 56827108 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | tert-butyl N-methyl-N-[2-(1-pyridin-3-ylethylcarbamoylamino)ethyl]carbamate |
| SMILES | CC(NC(=O)NCCN(C)C(=O)OC(C)(C)C)c1cccnc1 |
| InChI | InChI=1S/C16H26N4O3/c1-12(13-7-6-8-17-11-13)19-14(21)18-9-10-20(5)15(22)23-16(2,3)4/h6-8,11-12H,9-10H2,1-5H3,(H2,18,19,21) |
| InChIKey | JLDUATPWIQSFJS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |