C23H29N5O5 — CID 118684064
tert-butyl N-methyl-N-[2-[methyl-[[5-(4-nitrophenoxy)-2H-indazol-3-yl]methyl]amino]ethyl]carbamate (PubChem CID 118684064) has the molecular formula C23H29N5O5 and a molecular weight of 455.52 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[methyl-[[5-(4-nitrophenoxy)-2H-indazol-3-yl]methyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[methyl-[[5-(4-nitrophenoxy)-2H-indazol-3-yl]methyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 118684064 |
| Molecular Formula | C23H29N5O5 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[methyl-[[5-(4-nitrophenoxy)-2H-indazol-3-yl]methyl]amino]ethyl]carbamate |
| SMILES | CN(CCN(C)C(=O)OC(C)(C)C)Cc1[nH]nc2ccc(Oc3ccc([N+](=O)[O-])cc3)cc12 |
| InChI | InChI=1S/C23H29N5O5/c1-23(2,3)33-22(29)27(5)13-12-26(4)15-21-19-14-18(10-11-20(19)24-25-21)32-17-8-6-16(7-9-17)28(30)31/h6-11,14H,12-13,15H2,1-5H3,(H,24,25) |
| InChIKey | JCCYGOQLRAUCML-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|