C28H37N5O6 — CID 90460303
tert-butyl N-methyl-N-[2-[methyl-[[5-(4-nitrophenoxy)-1-(oxan-2-yl)indazol-3-yl]methyl]amino]ethyl]carbamate (PubChem CID 90460303) has the molecular formula C28H37N5O6 and a molecular weight of 539.63 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[methyl-[[5-(4-nitrophenoxy)-1-(oxan-2-yl)indazol-3-yl]methyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[methyl-[[5-(4-nitrophenoxy)-1-(oxan-2-yl)indazol-3-yl]methyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 90460303 |
| Molecular Formula | C28H37N5O6 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[methyl-[[5-(4-nitrophenoxy)-1-(oxan-2-yl)indazol-3-yl]methyl]amino]ethyl]carbamate |
| SMILES | CN(CCN(C)C(=O)OC(C)(C)C)Cc1nn(C2CCCCO2)c2ccc(Oc3ccc([N+](=O)[O-])cc3)cc12 |
| InChI | InChI=1S/C28H37N5O6/c1-28(2,3)39-27(34)31(5)16-15-30(4)19-24-23-18-22(38-21-11-9-20(10-12-21)33(35)36)13-14-25(23)32(29-24)26-8-6-7-17-37-26/h9-14,18,26H,6-8,15-17,19H2,1-5H3 |
| InChIKey | LHMBMJQPFRCVBE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 112.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|